C21H22Br2Cl2N2O3 — CID 98105983
6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2,5-dichlorophenyl)hexanamide (PubChem CID 98105983) has the molecular formula C21H22Br2Cl2N2O3 and a molecular weight of 581.13 g/mol. Its IUPAC name is 6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2,5-dichlorophenyl)hexanamide.
| Compound Name | 6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2,5-dichlorophenyl)hexanamide |
|---|---|
| PubChem CID | 98105983 |
| Molecular Formula | C21H22Br2Cl2N2O3 |
| Molecular Weight | 581.13 g/mol |
| Exact Mass | 577.94 |
| IUPAC Name | 6-[(1S,2R,6R,7R,8R,9S)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-(2,5-dichlorophenyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)[C@H]2[C@@H]3C[C@@H]([C@@H](Br)[C@H]3Br)[C@@H]2C1=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C21H22Br2Cl2N2O3/c22-18-11-9-12(19(18)23)17-16(11)20(29)27(21(17)30)7-3-1-2-4-15(28)26-14-8-10(24)5-6-13(14)25/h5-6,8,11-12,16-19H,1-4,7,9H2,(H,26,28)/t11-,12+,16-,17-,18-,19+/m0/s1 |
| InChIKey | LEPONHGAQRNSAC-VFBCTUTHSA-N |
| XLogP | 5.27 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.13 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|