C22H24Br3ClN2O3 — CID 5010037
N-(4-bromo-3-chloro-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide (PubChem CID 5010037) has the molecular formula C22H24Br3ClN2O3 and a molecular weight of 639.61 g/mol. Its IUPAC name is N-(4-bromo-3-chloro-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide.
| Compound Name | N-(4-bromo-3-chloro-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide |
|---|---|
| PubChem CID | 5010037 |
| Molecular Formula | C22H24Br3ClN2O3 |
| Molecular Weight | 639.61 g/mol |
| Exact Mass | 635.90 |
| IUPAC Name | N-(4-bromo-3-chloro-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide |
| SMILES | Cc1c(NC(=O)CCCCCN2C(=O)C3C4CC(C(Br)C4Br)C3C2=O)ccc(Br)c1Cl |
| InChI | InChI=1S/C22H24Br3ClN2O3/c1-10-14(7-6-13(23)20(10)26)27-15(29)5-3-2-4-8-28-21(30)16-11-9-12(17(16)22(28)31)19(25)18(11)24/h6-7,11-12,16-19H,2-5,8-9H2,1H3,(H,27,29) |
| InChIKey | YLABJBGWIRKLOW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|