C22H25Br2ClN2O4 — CID 100807346
N-(5-chloro-2-methoxyphenyl)-6-[(1R,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide (PubChem CID 100807346) has the molecular formula C22H25Br2ClN2O4 and a molecular weight of 576.71 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-6-[(1R,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-6-[(1R,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide |
|---|---|
| PubChem CID | 100807346 |
| Molecular Formula | C22H25Br2ClN2O4 |
| Molecular Weight | 576.71 g/mol |
| Exact Mass | 573.99 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-6-[(1R,2R,6R,7R,8R,9R)-8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]hexanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CCCCCN1C(=O)[C@H]2[C@H]3C[C@@H]([C@@H](Br)[C@@H]3Br)[C@@H]2C1=O |
| InChI | InChI=1S/C22H25Br2ClN2O4/c1-31-15-7-6-11(25)9-14(15)26-16(28)5-3-2-4-8-27-21(29)17-12-10-13(18(17)22(27)30)20(24)19(12)23/h6-7,9,12-13,17-20H,2-5,8,10H2,1H3,(H,26,28)/t12-,13-,17+,18+,19-,20-/m1/s1 |
| InChIKey | ASSQXHACRQPAIS-ZVSAPRDFSA-N |
| XLogP | 4.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|