C24H28N2O4 — CID 19646170
6-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-N-(2-methoxyphenyl)hexanamide (PubChem CID 19646170) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 6-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-N-(2-methoxyphenyl)hexanamide.
| Compound Name | 6-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-N-(2-methoxyphenyl)hexanamide |
|---|---|
| PubChem CID | 19646170 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 6-(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)-N-(2-methoxyphenyl)hexanamide |
| SMILES | COc1ccccc1NC(=O)CCCCCN1C(=O)C2C3C=CC(C4CC34)C2C1=O |
| InChI | InChI=1S/C24H28N2O4/c1-30-19-8-5-4-7-18(19)25-20(27)9-3-2-6-12-26-23(28)21-14-10-11-15(17-13-16(14)17)22(21)24(26)29/h4-5,7-8,10-11,14-17,21-22H,2-3,6,9,12-13H2,1H3,(H,25,27) |
| InChIKey | UISWTHPACLWBRT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|