C22H25Br3N2O3 — CID 3765413
N-(4-bromo-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide (PubChem CID 3765413) has the molecular formula C22H25Br3N2O3 and a molecular weight of 605.17 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide |
|---|---|
| PubChem CID | 3765413 |
| Molecular Formula | C22H25Br3N2O3 |
| Molecular Weight | 605.17 g/mol |
| Exact Mass | 601.94 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-6-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)hexanamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)CCCCCN1C(=O)C2C3CC(C(Br)C3Br)C2C1=O |
| InChI | InChI=1S/C22H25Br3N2O3/c1-11-9-12(23)6-7-15(11)26-16(28)5-3-2-4-8-27-21(29)17-13-10-14(18(17)22(27)30)20(25)19(13)24/h6-7,9,13-14,17-20H,2-5,8,10H2,1H3,(H,26,28) |
| InChIKey | SFGVSKXRNGQQKD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.17 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|