C21H23FN2O3 — CID 18851917
6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-fluorophenyl)hexanamide (PubChem CID 18851917) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is 6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-fluorophenyl)hexanamide.
| Compound Name | 6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-fluorophenyl)hexanamide |
|---|---|
| PubChem CID | 18851917 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 6-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)-N-(4-fluorophenyl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)C2C3C=CC(C3)C2C1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN2O3/c22-15-7-9-16(10-8-15)23-17(25)4-2-1-3-11-24-20(26)18-13-5-6-14(12-13)19(18)21(24)27/h5-10,13-14,18-19H,1-4,11-12H2,(H,23,25) |
| InChIKey | LLHCCARKNOSJRB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|