C19H17F3N2O4 — CID 98367128
3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 98367128) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is 3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 98367128 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 3-[(1R,2S,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@H]2C1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N2O4/c20-19(21,22)28-13-5-3-12(4-6-13)23-14(25)7-8-24-17(26)15-10-1-2-11(9-10)16(15)18(24)27/h1-6,10-11,15-16H,7-9H2,(H,23,25)/t10-,11-,15-,16-/m0/s1 |
| InChIKey | PJCJDLSHCFXOPM-GREKMHCPSA-N |
| XLogP | 2.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|