C21H29FN2O3 — CID 17035124
11-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)undecanamide (PubChem CID 17035124) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is 11-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)undecanamide.
| Compound Name | 11-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)undecanamide |
|---|---|
| PubChem CID | 17035124 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 11-(2,5-dioxopyrrolidin-1-yl)-N-(4-fluorophenyl)undecanamide |
| SMILES | O=C(CCCCCCCCCCN1C(=O)CCC1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C21H29FN2O3/c22-17-10-12-18(13-11-17)23-19(25)9-7-5-3-1-2-4-6-8-16-24-20(26)14-15-21(24)27/h10-13H,1-9,14-16H2,(H,23,25) |
| InChIKey | IXBOWZZNIVOHRE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|