C17H24ClN5O4 — CID 120603741
N-(2-aminoethyl)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]benzamide;hydrochloride (PubChem CID 120603741) has the molecular formula C17H24ClN5O4 and a molecular weight of 397.86 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120603741 |
| Molecular Formula | C17H24ClN5O4 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(2-aminoethyl)-2-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoylamino]benzamide;hydrochloride |
| SMILES | CN1CC(=O)N(CCCC(=O)Nc2ccccc2C(=O)NCCN)C1=O.Cl |
| InChI | InChI=1S/C17H23N5O4.ClH/c1-21-11-15(24)22(17(21)26)10-4-7-14(23)20-13-6-3-2-5-12(13)16(25)19-9-8-18;/h2-3,5-6H,4,7-11,18H2,1H3,(H,19,25)(H,20,23);1H |
| InChIKey | ORGWPUNWCPUWLS-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|