C16H24N4O3 — CID 120603511
N-[2-(2-aminoethylcarbamoyl)phenyl]-N',N'-dimethylpentanediamide (PubChem CID 120603511) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[2-(2-aminoethylcarbamoyl)phenyl]-N',N'-dimethylpentanediamide.
| Compound Name | N-[2-(2-aminoethylcarbamoyl)phenyl]-N',N'-dimethylpentanediamide |
|---|---|
| PubChem CID | 120603511 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | N-[2-(2-aminoethylcarbamoyl)phenyl]-N',N'-dimethylpentanediamide |
| SMILES | CN(C)C(=O)CCCC(=O)Nc1ccccc1C(=O)NCCN |
| InChI | InChI=1S/C16H24N4O3/c1-20(2)15(22)9-5-8-14(21)19-13-7-4-3-6-12(13)16(23)18-11-10-17/h3-4,6-7H,5,8-11,17H2,1-2H3,(H,18,23)(H,19,21) |
| InChIKey | JHUKPOLMPKUGTK-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |