C15H22N4O3 — CID 120603546
N-(2-aminoethyl)-2-[[2-(butanoylamino)acetyl]amino]benzamide (PubChem CID 120603546) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[2-(butanoylamino)acetyl]amino]benzamide.
| Compound Name | N-(2-aminoethyl)-2-[[2-(butanoylamino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 120603546 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | N-(2-aminoethyl)-2-[[2-(butanoylamino)acetyl]amino]benzamide |
| SMILES | CCCC(=O)NCC(=O)Nc1ccccc1C(=O)NCCN |
| InChI | InChI=1S/C15H22N4O3/c1-2-5-13(20)18-10-14(21)19-12-7-4-3-6-11(12)15(22)17-9-8-16/h3-4,6-7H,2,5,8-10,16H2,1H3,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | UTRVEVIYYVXGMX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |