C19H29ClN4O3 — CID 120604302
N-(2-aminoethyl)-2-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]benzamide;hydrochloride (PubChem CID 120604302) has the molecular formula C19H29ClN4O3 and a molecular weight of 396.92 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120604302 |
| Molecular Formula | C19H29ClN4O3 |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | N-(2-aminoethyl)-2-[[2-[(2-cyclohexylacetyl)amino]acetyl]amino]benzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1ccccc1NC(=O)CNC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C19H28N4O3.ClH/c20-10-11-21-19(26)15-8-4-5-9-16(15)23-18(25)13-22-17(24)12-14-6-2-1-3-7-14;/h4-5,8-9,14H,1-3,6-7,10-13,20H2,(H,21,26)(H,22,24)(H,23,25);1H |
| InChIKey | ZDCNPHDQOPAZLL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |