C19H25ClN4O4 — CID 120603377
N-(2-aminoethyl)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]benzamide;hydrochloride (PubChem CID 120603377) has the molecular formula C19H25ClN4O4 and a molecular weight of 408.89 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]benzamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120603377 |
| Molecular Formula | C19H25ClN4O4 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-(2-aminoethyl)-2-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]benzamide;hydrochloride |
| SMILES | Cl.NCCNC(=O)c1ccccc1NC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C19H24N4O4.ClH/c20-9-10-21-17(25)14-7-3-4-8-15(14)22-16(24)11-23-18(26)12-5-1-2-6-13(12)19(23)27;/h3-4,7-8,12-13H,1-2,5-6,9-11,20H2,(H,21,25)(H,22,24);1H |
| InChIKey | QPJVLWFXCBGGCJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|