C22H29N3O3 — CID 128925593
N-[2-(azepan-1-yl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide (PubChem CID 128925593) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide.
| Compound Name | N-[2-(azepan-1-yl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 128925593 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-[2-(azepan-1-yl)phenyl]-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)C2CCCCC2C1=O)Nc1ccccc1N1CCCCCC1 |
| InChI | InChI=1S/C22H29N3O3/c26-20(15-25-21(27)16-9-3-4-10-17(16)22(25)28)23-18-11-5-6-12-19(18)24-13-7-1-2-8-14-24/h5-6,11-12,16-17H,1-4,7-10,13-15H2,(H,23,26) |
| InChIKey | OVZJEDOTAAZJQK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|