C22H28N4O4 — CID 51631214
3-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-piperidin-1-ylbenzamide (PubChem CID 51631214) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is 3-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-piperidin-1-ylbenzamide.
| Compound Name | 3-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 51631214 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 3-[[2-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-piperidin-1-ylbenzamide |
| SMILES | NC(=O)c1ccc(N2CCCCC2)c(NC(=O)CN2C(=O)[C@H]3CCCC[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C22H28N4O4/c23-20(28)14-8-9-18(25-10-4-1-5-11-25)17(12-14)24-19(27)13-26-21(29)15-6-2-3-7-16(15)22(26)30/h8-9,12,15-16H,1-7,10-11,13H2,(H2,23,28)(H,24,27)/t15-,16-/m0/s1 |
| InChIKey | UEBJNZZERJTQRK-HOTGVXAUSA-N |
| XLogP | 1.89 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|