C19H22N2O5 — CID 7920523
methyl 3-[[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-methylbenzoate (PubChem CID 7920523) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl 3-[[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 7920523 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | methyl 3-[[2-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)CN2C(=O)[C@H]3CCCC[C@H]3C2=O)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-11-7-8-12(19(25)26-2)9-15(11)20-16(22)10-21-17(23)13-5-3-4-6-14(13)18(21)24/h7-9,13-14H,3-6,10H2,1-2H3,(H,20,22)/t13-,14+ |
| InChIKey | MCVDLYLOUTUZKZ-OKILXGFUSA-N |
| XLogP | 1.90 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|