C18H20FN3O4 — CID 55732741
3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-5-fluoro-4-methylbenzamide (PubChem CID 55732741) has the molecular formula C18H20FN3O4 and a molecular weight of 361.37 g/mol. Its IUPAC name is 3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 55732741 |
| Molecular Formula | C18H20FN3O4 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]amino]-5-fluoro-4-methylbenzamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NC(=O)CN1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C18H20FN3O4/c1-9-13(19)6-10(16(20)24)7-14(9)21-15(23)8-22-17(25)11-4-2-3-5-12(11)18(22)26/h6-7,11-12H,2-5,8H2,1H3,(H2,20,24)(H,21,23) |
| InChIKey | VRWFXNNREKBZKQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|