C13H15FN2O4 — CID 60940811
5-(5-carbamoyl-3-fluoro-2-methylanilino)-5-oxopentanoic acid (PubChem CID 60940811) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-(5-carbamoyl-3-fluoro-2-methylanilino)-5-oxopentanoic acid.
| Compound Name | 5-(5-carbamoyl-3-fluoro-2-methylanilino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 60940811 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-(5-carbamoyl-3-fluoro-2-methylanilino)-5-oxopentanoic acid |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NC(=O)CCCC(=O)O |
| InChI | InChI=1S/C13H15FN2O4/c1-7-9(14)5-8(13(15)20)6-10(7)16-11(17)3-2-4-12(18)19/h5-6H,2-4H2,1H3,(H2,15,20)(H,16,17)(H,18,19) |
| InChIKey | GOIWJMZGKWKTDB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |