C20H21FN2O4 — CID 78886176
3-[4-(4-acetylphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide (PubChem CID 78886176) has the molecular formula C20H21FN2O4 and a molecular weight of 372.40 g/mol. Its IUPAC name is 3-[4-(4-acetylphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[4-(4-acetylphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 78886176 |
| Molecular Formula | C20H21FN2O4 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 3-[4-(4-acetylphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)Nc2cc(C(N)=O)cc(F)c2C)cc1 |
| InChI | InChI=1S/C20H21FN2O4/c1-12-17(21)10-15(20(22)26)11-18(12)23-19(25)4-3-9-27-16-7-5-14(6-8-16)13(2)24/h5-8,10-11H,3-4,9H2,1-2H3,(H2,22,26)(H,23,25) |
| InChIKey | OUEGOFRXZAUHGZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|