C18H17ClFNO3 — CID 2634671
4-(4-acetylphenoxy)-N-(3-chloro-4-fluorophenyl)butanamide (PubChem CID 2634671) has the molecular formula C18H17ClFNO3 and a molecular weight of 349.79 g/mol. Its IUPAC name is 4-(4-acetylphenoxy)-N-(3-chloro-4-fluorophenyl)butanamide.
| Compound Name | 4-(4-acetylphenoxy)-N-(3-chloro-4-fluorophenyl)butanamide |
|---|---|
| PubChem CID | 2634671 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 4-(4-acetylphenoxy)-N-(3-chloro-4-fluorophenyl)butanamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H17ClFNO3/c1-12(22)13-4-7-15(8-5-13)24-10-2-3-18(23)21-14-6-9-17(20)16(19)11-14/h4-9,11H,2-3,10H2,1H3,(H,21,23) |
| InChIKey | MYPNHHTYCCMZHX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|