C23H28ClN3O4 — CID 71911956
4-[4-(4-acetylphenoxy)butanoylamino]-2-chloro-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 71911956) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is 4-[4-(4-acetylphenoxy)butanoylamino]-2-chloro-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-[4-(4-acetylphenoxy)butanoylamino]-2-chloro-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 71911956 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[4-(4-acetylphenoxy)butanoylamino]-2-chloro-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CC(=O)c1ccc(OCCCC(=O)Nc2ccc(C(=O)NCCN(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H28ClN3O4/c1-16(28)17-6-9-19(10-7-17)31-14-4-5-22(29)26-18-8-11-20(21(24)15-18)23(30)25-12-13-27(2)3/h6-11,15H,4-5,12-14H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | REXIIVKTDZRKBO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|