C20H23Cl2NO2 — CID 19173834
4-(4-tert-butylphenoxy)-N-(3,4-dichlorophenyl)butanamide (PubChem CID 19173834) has the molecular formula C20H23Cl2NO2 and a molecular weight of 380.32 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-(3,4-dichlorophenyl)butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-(3,4-dichlorophenyl)butanamide |
|---|---|
| PubChem CID | 19173834 |
| Molecular Formula | C20H23Cl2NO2 |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-(3,4-dichlorophenyl)butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23Cl2NO2/c1-20(2,3)14-6-9-16(10-7-14)25-12-4-5-19(24)23-15-8-11-17(21)18(22)13-15/h6-11,13H,4-5,12H2,1-3H3,(H,23,24) |
| InChIKey | QIRXMKKBHFCHAZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|