C21H26N2O3 — CID 2677123
4-[4-(4-tert-butylphenoxy)butanoylamino]benzamide (PubChem CID 2677123) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[4-(4-tert-butylphenoxy)butanoylamino]benzamide.
| Compound Name | 4-[4-(4-tert-butylphenoxy)butanoylamino]benzamide |
|---|---|
| PubChem CID | 2677123 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 4-[4-(4-tert-butylphenoxy)butanoylamino]benzamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O3/c1-21(2,3)16-8-12-18(13-9-16)26-14-4-5-19(24)23-17-10-6-15(7-11-17)20(22)25/h6-13H,4-5,14H2,1-3H3,(H2,22,25)(H,23,24) |
| InChIKey | SYVCCPMLTOTHFQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|