C12H18ClN3O3S — CID 43908500
2-chloro-N-[2-(dimethylamino)ethyl]-4-(methanesulfonamido)benzamide (PubChem CID 43908500) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-chloro-N-[2-(dimethylamino)ethyl]-4-(methanesulfonamido)benzamide.
| Compound Name | 2-chloro-N-[2-(dimethylamino)ethyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 43908500 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-chloro-N-[2-(dimethylamino)ethyl]-4-(methanesulfonamido)benzamide |
| SMILES | CN(C)CCNC(=O)c1ccc(NS(C)(=O)=O)cc1Cl |
| InChI | InChI=1S/C12H18ClN3O3S/c1-16(2)7-6-14-12(17)10-5-4-9(8-11(10)13)15-20(3,18)19/h4-5,8,15H,6-7H2,1-3H3,(H,14,17) |
| InChIKey | JJCYLEAKINPQOP-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |