C18H15ClN2O3S — CID 99951407
2-chloro-4-(methanesulfonamido)-N-naphthalen-2-ylbenzamide (PubChem CID 99951407) has the molecular formula C18H15ClN2O3S and a molecular weight of 374.85 g/mol. Its IUPAC name is 2-chloro-4-(methanesulfonamido)-N-naphthalen-2-ylbenzamide.
| Compound Name | 2-chloro-4-(methanesulfonamido)-N-naphthalen-2-ylbenzamide |
|---|---|
| PubChem CID | 99951407 |
| Molecular Formula | C18H15ClN2O3S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 2-chloro-4-(methanesulfonamido)-N-naphthalen-2-ylbenzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)Nc2ccc3ccccc3c2)c(Cl)c1 |
| InChI | InChI=1S/C18H15ClN2O3S/c1-25(23,24)21-15-8-9-16(17(19)11-15)18(22)20-14-7-6-12-4-2-3-5-13(12)10-14/h2-11,21H,1H3,(H,20,22) |
| InChIKey | DWYBBKWCDCXGFU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |