C17H17ClN2O5S — CID 99957500
methyl 3-[[2-chloro-4-(methanesulfonamido)benzoyl]amino]-2-methylbenzoate (PubChem CID 99957500) has the molecular formula C17H17ClN2O5S and a molecular weight of 396.85 g/mol. Its IUPAC name is methyl 3-[[2-chloro-4-(methanesulfonamido)benzoyl]amino]-2-methylbenzoate.
| Compound Name | methyl 3-[[2-chloro-4-(methanesulfonamido)benzoyl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 99957500 |
| Molecular Formula | C17H17ClN2O5S |
| Molecular Weight | 396.85 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | methyl 3-[[2-chloro-4-(methanesulfonamido)benzoyl]amino]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2ccc(NS(C)(=O)=O)cc2Cl)c1C |
| InChI | InChI=1S/C17H17ClN2O5S/c1-10-12(17(22)25-2)5-4-6-15(10)19-16(21)13-8-7-11(9-14(13)18)20-26(3,23)24/h4-9,20H,1-3H3,(H,19,21) |
| InChIKey | CKWGJUFQUUCXJE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |