C16H15ClN2O5S — CID 38015776
methyl 2-[[2-chloro-5-(methanesulfonamido)benzoyl]amino]benzoate (PubChem CID 38015776) has the molecular formula C16H15ClN2O5S and a molecular weight of 382.83 g/mol. Its IUPAC name is methyl 2-[[2-chloro-5-(methanesulfonamido)benzoyl]amino]benzoate.
| Compound Name | methyl 2-[[2-chloro-5-(methanesulfonamido)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 38015776 |
| Molecular Formula | C16H15ClN2O5S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | methyl 2-[[2-chloro-5-(methanesulfonamido)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cc(NS(C)(=O)=O)ccc1Cl |
| InChI | InChI=1S/C16H15ClN2O5S/c1-24-16(21)11-5-3-4-6-14(11)18-15(20)12-9-10(7-8-13(12)17)19-25(2,22)23/h3-9,19H,1-2H3,(H,18,20) |
| InChIKey | OBNKAVOUPHWPGI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |