C16H16ClN3O4S — CID 30397176
N-(4-acetamidophenyl)-2-chloro-5-(methanesulfonamido)benzamide (PubChem CID 30397176) has the molecular formula C16H16ClN3O4S and a molecular weight of 381.84 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-chloro-5-(methanesulfonamido)benzamide.
| Compound Name | N-(4-acetamidophenyl)-2-chloro-5-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 30397176 |
| Molecular Formula | C16H16ClN3O4S |
| Molecular Weight | 381.84 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | N-(4-acetamidophenyl)-2-chloro-5-(methanesulfonamido)benzamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)c2cc(NS(C)(=O)=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H16ClN3O4S/c1-10(21)18-11-3-5-12(6-4-11)19-16(22)14-9-13(7-8-15(14)17)20-25(2,23)24/h3-9,20H,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | HWAYEGAFGWOSCV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |