C20H20FN3O4 — CID 55784723
3-[4-(4-cyano-2-methoxyphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide (PubChem CID 55784723) has the molecular formula C20H20FN3O4 and a molecular weight of 385.40 g/mol. Its IUPAC name is 3-[4-(4-cyano-2-methoxyphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide.
| Compound Name | 3-[4-(4-cyano-2-methoxyphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 55784723 |
| Molecular Formula | C20H20FN3O4 |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-[4-(4-cyano-2-methoxyphenoxy)butanoylamino]-5-fluoro-4-methylbenzamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1cc(C(N)=O)cc(F)c1C |
| InChI | InChI=1S/C20H20FN3O4/c1-12-15(21)9-14(20(23)26)10-16(12)24-19(25)4-3-7-28-17-6-5-13(11-22)8-18(17)27-2/h5-6,8-10H,3-4,7H2,1-2H3,(H2,23,26)(H,24,25) |
| InChIKey | VTUYFYDGLSNSJQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 114.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|