C18H19N3O4 — CID 46484895
4-(4-cyano-2-methoxyphenoxy)-N-(6-methoxy-3-pyridinyl)butanamide (PubChem CID 46484895) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-(6-methoxy-3-pyridinyl)butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-(6-methoxy-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 46484895 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-(6-methoxy-3-pyridinyl)butanamide |
| SMILES | COc1ccc(NC(=O)CCCOc2ccc(C#N)cc2OC)cn1 |
| InChI | InChI=1S/C18H19N3O4/c1-23-16-10-13(11-19)5-7-15(16)25-9-3-4-17(22)21-14-6-8-18(24-2)20-12-14/h5-8,10,12H,3-4,9H2,1-2H3,(H,21,22) |
| InChIKey | LDWVJBLFRJFEIE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|