C23H26N2O4 — CID 48585204
4-(4-cyano-2-methoxyphenoxy)-N-[3-(cyclopropylmethoxymethyl)phenyl]butanamide (PubChem CID 48585204) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[3-(cyclopropylmethoxymethyl)phenyl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(cyclopropylmethoxymethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 48585204 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[3-(cyclopropylmethoxymethyl)phenyl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1cccc(COCC2CC2)c1 |
| InChI | InChI=1S/C23H26N2O4/c1-27-22-13-18(14-24)9-10-21(22)29-11-3-6-23(26)25-20-5-2-4-19(12-20)16-28-15-17-7-8-17/h2,4-5,9-10,12-13,17H,3,6-8,11,15-16H2,1H3,(H,25,26) |
| InChIKey | ZZDJVMNMKNVCIP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|