C26H24FN3O4 — CID 55894063
N-[3-[[4-(4-cyano-2-methoxyphenoxy)butanoylamino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 55894063) has the molecular formula C26H24FN3O4 and a molecular weight of 461.49 g/mol. Its IUPAC name is N-[3-[[4-(4-cyano-2-methoxyphenoxy)butanoylamino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-[[4-(4-cyano-2-methoxyphenoxy)butanoylamino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 55894063 |
| Molecular Formula | C26H24FN3O4 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-[3-[[4-(4-cyano-2-methoxyphenoxy)butanoylamino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)NCc1cccc(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H24FN3O4/c1-33-24-14-18(16-28)10-11-23(24)34-12-4-9-25(31)29-17-19-5-2-8-22(13-19)30-26(32)20-6-3-7-21(27)15-20/h2-3,5-8,10-11,13-15H,4,9,12,17H2,1H3,(H,29,31)(H,30,32) |
| InChIKey | RKLNRCIKJOYRMI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|