C26H25FN2O4 — CID 55982902
N-[3-[[3-(3-ethoxy-4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 55982902) has the molecular formula C26H25FN2O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[3-[[3-(3-ethoxy-4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-[[3-(3-ethoxy-4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 55982902 |
| Molecular Formula | C26H25FN2O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[3-[[3-(3-ethoxy-4-methoxyphenyl)prop-2-enoylamino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | CCOc1cc(C=CC(=O)NCc2cccc(NC(=O)c3cccc(F)c3)c2)ccc1OC |
| InChI | InChI=1S/C26H25FN2O4/c1-3-33-24-15-18(10-12-23(24)32-2)11-13-25(30)28-17-19-6-4-9-22(14-19)29-26(31)20-7-5-8-21(27)16-20/h4-16H,3,17H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | HHGGIYYOXOFLRJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|