C24H28N2O4 — CID 60535477
N-[3-[[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 60535477) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[3-[[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 60535477 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[3-[[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2cccc(NC(=O)C3CCCC3)c2)cc1OC |
| InChI | InChI=1S/C24H28N2O4/c1-29-21-12-10-17(15-22(21)30-2)11-13-23(27)25-16-18-6-5-9-20(14-18)26-24(28)19-7-3-4-8-19/h5-6,9-15,19H,3-4,7-8,16H2,1-2H3,(H,25,27)(H,26,28)/b13-11+ |
| InChIKey | XNMKDPMLRQADIP-ACCUITESSA-N |
| XLogP | 4.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|