C23H25N3O4S — CID 46761569
N-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-2-methylphenyl]cyclopropanecarboxamide (PubChem CID 46761569) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is N-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-2-methylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-2-methylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 46761569 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | N-[3-[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]carbamothioylamino]-2-methylphenyl]cyclopropanecarboxamide |
| SMILES | COc1ccc(/C=C/C(=O)NC(=S)Nc2cccc(NC(=O)C3CC3)c2C)cc1OC |
| InChI | InChI=1S/C23H25N3O4S/c1-14-17(24-22(28)16-9-10-16)5-4-6-18(14)25-23(31)26-21(27)12-8-15-7-11-19(29-2)20(13-15)30-3/h4-8,11-13,16H,9-10H2,1-3H3,(H,24,28)(H2,25,26,27,31)/b12-8+ |
| InChIKey | KYJFUGNLZYPOCI-XYOKQWHBSA-N |
| XLogP | 3.89 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|