C22H23N3O4 — CID 60535387
N-[3-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide (PubChem CID 60535387) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[3-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide.
| Compound Name | N-[3-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 60535387 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[3-[[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl]cyclopentanecarboxamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)NCc1cccc(NC(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C22H23N3O4/c26-21(13-10-16-8-11-20(12-9-16)25(28)29)23-15-17-4-3-7-19(14-17)24-22(27)18-5-1-2-6-18/h3-4,7-14,18H,1-2,5-6,15H2,(H,23,26)(H,24,27)/b13-10+ |
| InChIKey | RWMKMKSZIUQMHZ-JLHYYAGUSA-N |
| XLogP | 4.05 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|