C24H28N2O4 — CID 55573525
N-[3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 55573525) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-[3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 55573525 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-[3-[[(E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(NC(=O)C3CC3)c2)ccc1OCC(C)C |
| InChI | InChI=1S/C24H28N2O4/c1-16(2)15-30-21-11-7-17(13-22(21)29-3)8-12-23(27)25-19-5-4-6-20(14-19)26-24(28)18-9-10-18/h4-8,11-14,16,18H,9-10,15H2,1-3H3,(H,25,27)(H,26,28)/b12-8+ |
| InChIKey | MYWOSFYKLJNYBA-XYOKQWHBSA-N |
| XLogP | 4.73 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|