C23H28N2O4 — CID 24673568
(E)-N-(3-acetamido-2-methylphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide (PubChem CID 24673568) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (E)-N-(3-acetamido-2-methylphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(3-acetamido-2-methylphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24673568 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (E)-N-(3-acetamido-2-methylphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2cccc(NC(C)=O)c2C)ccc1OCC(C)C |
| InChI | InChI=1S/C23H28N2O4/c1-15(2)14-29-21-11-9-18(13-22(21)28-5)10-12-23(27)25-20-8-6-7-19(16(20)3)24-17(4)26/h6-13,15H,14H2,1-5H3,(H,24,26)(H,25,27)/b12-10+ |
| InChIKey | JLBGGEDASZIMTM-ZRDIBKRKSA-N |
| XLogP | 4.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|