C22H27NO5 — CID 18272734
(E)-N-(2,4-dimethoxyphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide (PubChem CID 18272734) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (E)-N-(2,4-dimethoxyphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(2,4-dimethoxyphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 18272734 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (E)-N-(2,4-dimethoxyphenyl)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2ccc(OCC(C)C)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C22H27NO5/c1-15(2)14-28-19-10-6-16(12-21(19)27-5)7-11-22(24)23-18-9-8-17(25-3)13-20(18)26-4/h6-13,15H,14H2,1-5H3,(H,23,24)/b11-7+ |
| InChIKey | SOCNUDASIXBNGY-YRNVUSSQSA-N |
| XLogP | 4.40 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|