C23H25N3O4 — CID 55731623
3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]prop-2-enamide (PubChem CID 55731623) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | 3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55731623 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 3-[3-methoxy-4-(2-methylpropoxy)phenyl]-N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2cc(-c3nnco3)ccc2C)ccc1OCC(C)C |
| InChI | InChI=1S/C23H25N3O4/c1-15(2)13-29-20-9-6-17(11-21(20)28-4)7-10-22(27)25-19-12-18(8-5-16(19)3)23-26-24-14-30-23/h5-12,14-15H,13H2,1-4H3,(H,25,27) |
| InChIKey | NVFRSPHJYPEBRB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|