C25H31NO5 — CID 8741142
[(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate (PubChem CID 8741142) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate.
| Compound Name | [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8741142 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | [(2S)-1-(2,5-dimethylanilino)-1-oxopropan-2-yl] (E)-3-[3-methoxy-4-(2-methylpropoxy)phenyl]prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2cc(C)ccc2C)ccc1OCC(C)C |
| InChI | InChI=1S/C25H31NO5/c1-16(2)15-30-22-11-9-20(14-23(22)29-6)10-12-24(27)31-19(5)25(28)26-21-13-17(3)7-8-18(21)4/h7-14,16,19H,15H2,1-6H3,(H,26,28)/b12-10+/t19-/m0/s1 |
| InChIKey | ZNGLFKYAYCIFDD-RDELFYGPSA-N |
| XLogP | 4.93 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|