C24H29NO5 — CID 1410120
[(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate (PubChem CID 1410120) has the molecular formula C24H29NO5 and a molecular weight of 411.50 g/mol. Its IUPAC name is [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate.
| Compound Name | [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 1410120 |
| Molecular Formula | C24H29NO5 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(3-methoxy-4-propan-2-yloxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C)C(=O)Nc2ccc(C)cc2C)ccc1OC(C)C |
| InChI | InChI=1S/C24H29NO5/c1-15(2)29-21-11-8-19(14-22(21)28-6)9-12-23(26)30-18(5)24(27)25-20-10-7-16(3)13-17(20)4/h7-15,18H,1-6H3,(H,25,27)/b12-9+/t18-/m0/s1 |
| InChIKey | NJXZCEUMXOUAOQ-PEKVBPLLSA-N |
| XLogP | 4.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|