C20H21NO3 — CID 5101559
[1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate (PubChem CID 5101559) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate.
| Compound Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 5101559 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-phenylprop-2-enoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)C=Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C20H21NO3/c1-14-9-11-18(15(2)13-14)21-20(23)16(3)24-19(22)12-10-17-7-5-4-6-8-17/h4-13,16H,1-3H3,(H,21,23) |
| InChIKey | IOJHQTZWNDOKER-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|