C16H21NO3 — CID 9063239
[(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate (PubChem CID 9063239) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate.
| Compound Name | [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 9063239 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [(2S)-1-(2,4-dimethylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)O[C@@H](C)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C16H21NO3/c1-5-6-7-15(18)20-13(4)16(19)17-14-9-8-11(2)10-12(14)3/h6-10,13H,5H2,1-4H3,(H,17,19)/b7-6+/t13-/m0/s1 |
| InChIKey | GQXPUXSHNGWPQQ-YBJDMEARSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|