C16H20ClNO4 — CID 9063301
[(2R)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate (PubChem CID 9063301) has the molecular formula C16H20ClNO4 and a molecular weight of 325.79 g/mol. Its IUPAC name is [(2R)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate.
| Compound Name | [(2R)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate |
|---|---|
| PubChem CID | 9063301 |
| Molecular Formula | C16H20ClNO4 |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [(2R)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] (E)-pent-2-enoate |
| SMILES | CC/C=C/C(=O)O[C@H](C)C(=O)Nc1cc(C)c(Cl)cc1OC |
| InChI | InChI=1S/C16H20ClNO4/c1-5-6-7-15(19)22-11(3)16(20)18-13-8-10(2)12(17)9-14(13)21-4/h6-9,11H,5H2,1-4H3,(H,18,20)/b7-6+/t11-/m1/s1 |
| InChIKey | KLJJYXSTYLRYQT-XUIVZRPNSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|