C16H17ClN2O4 — CID 9310800
[(2S)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate (PubChem CID 9310800) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is [(2S)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(2S)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9310800 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [(2S)-1-(4-chloro-2-methoxy-5-methylanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)[C@H](C)OC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C16H17ClN2O4/c1-9-7-13(14(22-3)8-11(9)17)19-15(20)10(2)23-16(21)12-5-4-6-18-12/h4-8,10,18H,1-3H3,(H,19,20)/t10-/m0/s1 |
| InChIKey | GHODOQQFMARWMK-JTQLQIEISA-N |
| XLogP | 3.17 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |