C27H25Cl2NO4 — CID 4051270
[1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 4051270) has the molecular formula C27H25Cl2NO4 and a molecular weight of 498.41 g/mol. Its IUPAC name is [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 4051270 |
| Molecular Formula | C27H25Cl2NO4 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | [1-(2,4-dimethylanilino)-1-oxopropan-2-yl] 3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1ccc(NC(=O)C(C)OC(=O)C=Cc2ccc(OCc3c(Cl)cccc3Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C27H25Cl2NO4/c1-17-7-13-25(18(2)15-17)30-27(32)19(3)34-26(31)14-10-20-8-11-21(12-9-20)33-16-22-23(28)5-4-6-24(22)29/h4-15,19H,16H2,1-3H3,(H,30,32) |
| InChIKey | LRJYSLLEQKCRBJ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|