C28H28ClNO4 — CID 6998811
[(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate (PubChem CID 6998811) has the molecular formula C28H28ClNO4 and a molecular weight of 477.99 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 6998811 |
| Molecular Formula | C28H28ClNO4 |
| Molecular Weight | 477.99 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] 3-[4-[(2-chlorophenyl)methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1cc(C)c(NC(=O)[C@H](C)OC(=O)C=Cc2ccc(OCc3ccccc3Cl)cc2)c(C)c1 |
| InChI | InChI=1S/C28H28ClNO4/c1-18-15-19(2)27(20(3)16-18)30-28(32)21(4)34-26(31)14-11-22-9-12-24(13-10-22)33-17-23-7-5-6-8-25(23)29/h5-16,21H,17H2,1-4H3,(H,30,32)/t21-/m0/s1 |
| InChIKey | XPNRNBNPIBSODC-NRFANRHFSA-N |
| XLogP | 6.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.99 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|