C21H23NO3 — CID 8740476
[(2R)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 8740476) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is [(2R)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [(2R)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8740476 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [(2R)-1-(2,6-dimethylanilino)-1-oxopropan-2-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)O[C@H](C)C(=O)Nc2c(C)cccc2C)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-14-8-10-18(11-9-14)12-13-19(23)25-17(4)21(24)22-20-15(2)6-5-7-16(20)3/h5-13,17H,1-4H3,(H,22,24)/b13-12+/t17-/m1/s1 |
| InChIKey | QOAYGOHCNDQXEJ-GZKZCVOOSA-N |
| XLogP | 4.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|