C21H22BrNO3 — CID 7486502
[(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 7486502) has the molecular formula C21H22BrNO3 and a molecular weight of 416.32 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7486502 |
| Molecular Formula | C21H22BrNO3 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [(2S)-1-oxo-1-(2,4,6-trimethylanilino)propan-2-yl] (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | Cc1cc(C)c(NC(=O)[C@H](C)OC(=O)/C=C/c2ccc(Br)cc2)c(C)c1 |
| InChI | InChI=1S/C21H22BrNO3/c1-13-11-14(2)20(15(3)12-13)23-21(25)16(4)26-19(24)10-7-17-5-8-18(22)9-6-17/h5-12,16H,1-4H3,(H,23,25)/b10-7+/t16-/m0/s1 |
| InChIKey | TZUMKGOWSVGIDC-JCVNQNCUSA-N |
| XLogP | 4.96 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|